C16H28F3NO — CID 10518823
N,N-dibutyl-3-ethyl-2-(trifluoromethyl)pent-2-enamide (PubChem CID 10518823) has the molecular formula C16H28F3NO and a molecular weight of 307.40 g/mol. Its IUPAC name is N,N-dibutyl-3-ethyl-2-(trifluoromethyl)pent-2-enamide.
| Compound Name | N,N-dibutyl-3-ethyl-2-(trifluoromethyl)pent-2-enamide |
|---|---|
| PubChem CID | 10518823 |
| Molecular Formula | C16H28F3NO |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N,N-dibutyl-3-ethyl-2-(trifluoromethyl)pent-2-enamide |
| SMILES | CCCCN(CCCC)C(=O)C(=C(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C16H28F3NO/c1-5-9-11-20(12-10-6-2)15(21)14(16(17,18)19)13(7-3)8-4/h5-12H2,1-4H3 |
| InChIKey | PTAQGLOCIXJTBE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|