C10H11F8NO — CID 23266377
(Z)-N,N-diethyl-3,4,5,5,5-pentafluoro-2-(trifluoromethyl)pent-2-enamide (PubChem CID 23266377) has the molecular formula C10H11F8NO and a molecular weight of 313.19 g/mol. Its IUPAC name is (Z)-N,N-diethyl-3,4,5,5,5-pentafluoro-2-(trifluoromethyl)pent-2-enamide.
| Compound Name | (Z)-N,N-diethyl-3,4,5,5,5-pentafluoro-2-(trifluoromethyl)pent-2-enamide |
|---|---|
| PubChem CID | 23266377 |
| Molecular Formula | C10H11F8NO |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (Z)-N,N-diethyl-3,4,5,5,5-pentafluoro-2-(trifluoromethyl)pent-2-enamide |
| SMILES | CCN(CC)C(=O)/C(=C(/F)C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F8NO/c1-3-19(4-2)8(20)5(9(13,14)15)6(11)7(12)10(16,17)18/h7H,3-4H2,1-2H3/b6-5- |
| InChIKey | QEOPURBKRBVJHP-WAYWQWQTSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|