C17H28F3NO — CID 10947134
N,N-dibutyl-2-cyclohexylidene-3,3,3-trifluoropropanamide (PubChem CID 10947134) has the molecular formula C17H28F3NO and a molecular weight of 319.41 g/mol. Its IUPAC name is N,N-dibutyl-2-cyclohexylidene-3,3,3-trifluoropropanamide.
| Compound Name | N,N-dibutyl-2-cyclohexylidene-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 10947134 |
| Molecular Formula | C17H28F3NO |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N,N-dibutyl-2-cyclohexylidene-3,3,3-trifluoropropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(=C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C17H28F3NO/c1-3-5-12-21(13-6-4-2)16(22)15(17(18,19)20)14-10-8-7-9-11-14/h3-13H2,1-2H3 |
| InChIKey | QYPDBXAQOYOYHO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|