C10H17NO — CID 143588066
1,5-dimethyl-4-propyl-2,3-dihydropyridin-6-one (PubChem CID 143588066) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1,5-dimethyl-4-propyl-2,3-dihydropyridin-6-one.
| Compound Name | 1,5-dimethyl-4-propyl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 143588066 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1,5-dimethyl-4-propyl-2,3-dihydropyridin-6-one |
| SMILES | CCCC1=C(C)C(=O)N(C)CC1 |
| InChI | InChI=1S/C10H17NO/c1-4-5-9-6-7-11(3)10(12)8(9)2/h4-7H2,1-3H3 |
| InChIKey | UMTJHIIQDSGLBL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |