About 2-cyclohexylidene-N,N-diethylpropanamide
2-cyclohexylidene-N,N-diethylpropanamide (PubChem CID 102303656) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-cyclohexylidene-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-cyclohexylidene-N,N-diethylpropanamide |
| PubChem CID | 102303656 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-cyclohexylidene-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)=C1CCCCC1 |
| InChI | InChI=1S/C13H23NO/c1-4-14(5-2)13(15)11(3)12-9-7-6-8-10-12/h4-10H2,1-3H3 |
| InChIKey | DKLUADDUJPBFBR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylidene-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylidene-N,N-diethylpropanamide?
The IUPAC name of 2-cyclohexylidene-N,N-diethylpropanamide (CID 102303656) is 2-cyclohexylidene-N,N-diethylpropanamide.
What is the SMILES notation for 2-cyclohexylidene-N,N-diethylpropanamide?
The canonical SMILES for 2-cyclohexylidene-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)=C1CCCCC1.
What is the InChIKey of 2-cyclohexylidene-N,N-diethylpropanamide?
The InChIKey is DKLUADDUJPBFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-4-14(5-2)13(15)11(3)12-9-7-6-8-10-12/h4-10H2,1-3H3.
What are the key properties of 2-cyclohexylidene-N,N-diethylpropanamide?
2-cyclohexylidene-N,N-diethylpropanamide has a molecular weight of 209.33 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylidene-N,N-diethylpropanamide is sourced from PubChem (CID 102303656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).