C12H19NO — CID 123983578
1,2,3,6,7-pentamethyl-4,5-dihydroazocin-8-one (PubChem CID 123983578) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1,2,3,6,7-pentamethyl-4,5-dihydroazocin-8-one.
| Compound Name | 1,2,3,6,7-pentamethyl-4,5-dihydroazocin-8-one |
|---|---|
| PubChem CID | 123983578 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1,2,3,6,7-pentamethyl-4,5-dihydroazocin-8-one |
| SMILES | CC1=C(C)C(=O)N(C)C(C)=C(C)CC1 |
| InChI | InChI=1S/C12H19NO/c1-8-6-7-9(2)11(4)13(5)12(14)10(8)3/h6-7H2,1-5H3 |
| InChIKey | MLYLPUSRMXLQQN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |