C11H15NO2 — CID 121219922
1,3,4,6,7-pentamethylazepine-2,5-dione (PubChem CID 121219922) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1,3,4,6,7-pentamethylazepine-2,5-dione.
| Compound Name | 1,3,4,6,7-pentamethylazepine-2,5-dione |
|---|---|
| PubChem CID | 121219922 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1,3,4,6,7-pentamethylazepine-2,5-dione |
| SMILES | Cc1c(C)c(=O)n(C)c(C)c(C)c1=O |
| InChI | InChI=1S/C11H15NO2/c1-6-7(2)11(14)12(5)9(4)8(3)10(6)13/h1-5H3 |
| InChIKey | GSQOECPFSCPOCP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |