C13H25NO — CID 140860510
N-ethyl-N,2-dimethylnon-2-enamide (PubChem CID 140860510) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N-ethyl-N,2-dimethylnon-2-enamide.
| Compound Name | N-ethyl-N,2-dimethylnon-2-enamide |
|---|---|
| PubChem CID | 140860510 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-ethyl-N,2-dimethylnon-2-enamide |
| SMILES | CCCCCCC=C(C)C(=O)N(C)CC |
| InChI | InChI=1S/C13H25NO/c1-5-7-8-9-10-11-12(3)13(15)14(4)6-2/h11H,5-10H2,1-4H3 |
| InChIKey | VRBDGXMSWWIBEM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|