C24H27N5O2 — CID 10202089
4-(2-methoxyphenyl)-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]piperazine-1-carboxamide (PubChem CID 10202089) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-methoxyphenyl)-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10202089 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-(2-methoxyphenyl)-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]piperazine-1-carboxamide |
| SMILES | COc1ccccc1N1CCN(C(=O)N/C(N)=N/Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H27N5O2/c1-31-22-12-5-4-11-21(22)28-13-15-29(16-14-28)24(30)27-23(25)26-17-19-9-6-8-18-7-2-3-10-20(18)19/h2-12H,13-17H2,1H3,(H3,25,26,27,30) |
| InChIKey | JRLJFLWPLMJTPJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|