C42H44N2O4 — CID 102022974
3-hydroxy-2-[[(1S,2S)-2-[[3-hydroxy-2-(2,4,6-trimethylbenzoyl)but-3-enylidene]amino]-1,2-diphenylethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)but-3-en-1-one (PubChem CID 102022974) has the molecular formula C42H44N2O4 and a molecular weight of 640.82 g/mol. Its IUPAC name is 3-hydroxy-2-[[(1S,2S)-2-[[3-hydroxy-2-(2,4,6-trimethylbenzoyl)but-3-enylidene]amino]-1,2-diphenylethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)but-3-en-1-one.
| Compound Name | 3-hydroxy-2-[[(1S,2S)-2-[[3-hydroxy-2-(2,4,6-trimethylbenzoyl)but-3-enylidene]amino]-1,2-diphenylethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)but-3-en-1-one |
|---|---|
| PubChem CID | 102022974 |
| Molecular Formula | C42H44N2O4 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 3-hydroxy-2-[[(1S,2S)-2-[[3-hydroxy-2-(2,4,6-trimethylbenzoyl)but-3-enylidene]amino]-1,2-diphenylethyl]iminomethyl]-1-(2,4,6-trimethylphenyl)but-3-en-1-one |
| SMILES | C=C(O)C(/C=N/[C@@H](c1ccccc1)[C@@H](/N=C/C(C(=C)O)C(=O)c1c(C)cc(C)cc1C)c1ccccc1)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C42H44N2O4/c1-25-19-27(3)37(28(4)20-25)41(47)35(31(7)45)23-43-39(33-15-11-9-12-16-33)40(34-17-13-10-14-18-34)44-24-36(32(8)46)42(48)38-29(5)21-26(2)22-30(38)6/h9-24,35-36,39-40,45-46H,7-8H2,1-6H3/b43-23+,44-24+/t35?,36?,39-,40-/m0/s1 |
| InChIKey | PZGQINMITNZTAX-BHCLPVDLSA-N |
| XLogP | 9.60 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|