C41H42N2O4 — CID 20650026
1-(2,4-dimethylphenyl)-2-[[2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]-1,2-diphenylethyl]iminomethyl]butane-1,3-dione (PubChem CID 20650026) has the molecular formula C41H42N2O4 and a molecular weight of 626.80 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-[[2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]-1,2-diphenylethyl]iminomethyl]butane-1,3-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-2-[[2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]-1,2-diphenylethyl]iminomethyl]butane-1,3-dione |
|---|---|
| PubChem CID | 20650026 |
| Molecular Formula | C41H42N2O4 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-[[2-[[3-oxo-2-(2,4,6-trimethylbenzoyl)butylidene]amino]-1,2-diphenylethyl]iminomethyl]butane-1,3-dione |
| SMILES | CC(=O)C(/C=N/C(c1ccccc1)C(/N=C/C(C(C)=O)C(=O)c1c(C)cc(C)cc1C)c1ccccc1)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C41H42N2O4/c1-25-18-19-34(27(3)20-25)40(46)35(30(6)44)23-42-38(32-14-10-8-11-15-32)39(33-16-12-9-13-17-33)43-24-36(31(7)45)41(47)37-28(4)21-26(2)22-29(37)5/h8-24,35-36,38-39H,1-7H3/b42-23+,43-24+ |
| InChIKey | IIQITLZKPPHPGU-OHTZCZJBSA-N |
| XLogP | 8.33 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|