C32H40N2O4 — CID 90976106
3-[[2-[(2-acetyl-3-oxobutylidene)amino]-1-(2,4,5-trimethylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione (PubChem CID 90976106) has the molecular formula C32H40N2O4 and a molecular weight of 516.68 g/mol. Its IUPAC name is 3-[[2-[(2-acetyl-3-oxobutylidene)amino]-1-(2,4,5-trimethylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione.
| Compound Name | 3-[[2-[(2-acetyl-3-oxobutylidene)amino]-1-(2,4,5-trimethylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 90976106 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 3-[[2-[(2-acetyl-3-oxobutylidene)amino]-1-(2,4,5-trimethylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]iminomethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(/C=N/C(c1cc(C)c(C)cc1C)C(/N=C/C(C(C)=O)C(C)=O)c1c(C)cc(C)cc1C)C(C)=O |
| InChI | InChI=1S/C32H40N2O4/c1-17-11-21(5)30(22(6)12-17)32(34-16-29(25(9)37)26(10)38)31(33-15-28(23(7)35)24(8)36)27-14-19(3)18(2)13-20(27)4/h11-16,28-29,31-32H,1-10H3/b33-15+,34-16+ |
| InChIKey | VJTVFSMDHXAMRQ-KXJQYHRCSA-N |
| XLogP | 6.05 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|