C40H52N2O6 — CID 101142995
cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-oxobutylidene)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-oxobutanoate (PubChem CID 101142995) has the molecular formula C40H52N2O6 and a molecular weight of 656.86 g/mol. Its IUPAC name is cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-oxobutylidene)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-oxobutanoate.
| Compound Name | cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-oxobutylidene)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 101142995 |
| Molecular Formula | C40H52N2O6 |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.38 |
| IUPAC Name | cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-oxobutylidene)amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-oxobutanoate |
| SMILES | CC(=O)C(/C=N/[C@@H](c1c(C)cc(C)cc1C)[C@@H](/N=C/C(C(C)=O)C(=O)OC1CCCC1)c1c(C)cc(C)cc1C)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C40H52N2O6/c1-23-17-25(3)35(26(4)18-23)37(41-21-33(29(7)43)39(45)47-31-13-9-10-14-31)38(36-27(5)19-24(2)20-28(36)6)42-22-34(30(8)44)40(46)48-32-15-11-12-16-32/h17-22,31-34,37-38H,9-16H2,1-8H3/b41-21+,42-22+/t33?,34?,37-,38-/m0/s1 |
| InChIKey | AZZQFGQDBGVCAL-GSYIIWKFSA-N |
| XLogP | 7.84 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|