C42H42MnN2O4+ — CID 139264688
manganese(3+);[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]-[(1S,2S)-2-[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]azanidyl-1,2-diphenylethyl]azanide (PubChem CID 139264688) has the molecular formula C42H42MnN2O4+ and a molecular weight of 693.75 g/mol. Its IUPAC name is manganese(3+);[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]-[(1S,2S)-2-[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]azanidyl-1,2-diphenylethyl]azanide.
| Compound Name | manganese(3+);[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]-[(1S,2S)-2-[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]azanidyl-1,2-diphenylethyl]azanide |
|---|---|
| PubChem CID | 139264688 |
| Molecular Formula | C42H42MnN2O4+ |
| Molecular Weight | 693.75 g/mol |
| Exact Mass | 693.25 |
| IUPAC Name | manganese(3+);[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]-[(1S,2S)-2-[(E)-3-oxo-2-(2,4,6-trimethylbenzoyl)but-1-enyl]azanidyl-1,2-diphenylethyl]azanide |
| SMILES | CC(=O)/C(=C\[N-][C@@H](c1ccccc1)[C@@H]([N-]/C=C(\C(C)=O)C(=O)c1c(C)cc(C)cc1C)c1ccccc1)C(=O)c1c(C)cc(C)cc1C.[Mn+3] |
| InChI | InChI=1S/C42H44N2O4.Mn/c1-25-19-27(3)37(28(4)20-25)41(47)35(31(7)45)23-43-39(33-15-11-9-12-16-33)40(34-17-13-10-14-18-34)44-24-36(32(8)46)42(48)38-29(5)21-26(2)22-30(38)6;/h9-24,39-40H,1-8H3,(H2,43,44,45,46,47,48);/q;+3/p-2/t39-,40-;/m0./s1 |
| InChIKey | SVBFEBJDMDZVKP-OFUZFLEOSA-L |
| XLogP | 9.78 |
| TPSA | 96.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.75 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|