C20H23FN2O5S — CID 10202444
N-(2-fluoroethyl)-1-methyl-N-(3,4,5-trimethoxyphenyl)indole-5-sulfonamide (PubChem CID 10202444) has the molecular formula C20H23FN2O5S and a molecular weight of 422.48 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-methyl-N-(3,4,5-trimethoxyphenyl)indole-5-sulfonamide.
| Compound Name | N-(2-fluoroethyl)-1-methyl-N-(3,4,5-trimethoxyphenyl)indole-5-sulfonamide |
|---|---|
| PubChem CID | 10202444 |
| Molecular Formula | C20H23FN2O5S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-(2-fluoroethyl)-1-methyl-N-(3,4,5-trimethoxyphenyl)indole-5-sulfonamide |
| SMILES | COc1cc(N(CCF)S(=O)(=O)c2ccc3c(ccn3C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23FN2O5S/c1-22-9-7-14-11-16(5-6-17(14)22)29(24,25)23(10-8-21)15-12-18(26-2)20(28-4)19(13-15)27-3/h5-7,9,11-13H,8,10H2,1-4H3 |
| InChIKey | COGFZDMHBQJXHM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |