C18H23NO4 — CID 102024519
ethyl 2-[(3R,7R,8aS)-8a-methyl-5-oxo-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate (PubChem CID 102024519) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl 2-[(3R,7R,8aS)-8a-methyl-5-oxo-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate.
| Compound Name | ethyl 2-[(3R,7R,8aS)-8a-methyl-5-oxo-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate |
|---|---|
| PubChem CID | 102024519 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethyl 2-[(3R,7R,8aS)-8a-methyl-5-oxo-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC(=O)N2[C@H](c3ccccc3)CO[C@@]2(C)C1 |
| InChI | InChI=1S/C18H23NO4/c1-3-22-17(21)10-13-9-16(20)19-15(12-23-18(19,2)11-13)14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3/t13-,15+,18+/m1/s1 |
| InChIKey | ICRWVPAOGGKBDI-XUWXXGDYSA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |