C21H27NO4S2 — CID 11270132
ethyl 2-[(3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]-1,3-dithiolane-2-carboxylate (PubChem CID 11270132) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is ethyl 2-[(3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]-1,3-dithiolane-2-carboxylate.
| Compound Name | ethyl 2-[(3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]-1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 11270132 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | ethyl 2-[(3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]-1,3-dithiolane-2-carboxylate |
| SMILES | CCOC(=O)C1([C@@H]2CC(=O)N3[C@H](OC[C@H]3c3ccccc3)[C@H]2CC)SCCS1 |
| InChI | InChI=1S/C21H27NO4S2/c1-3-15-16(21(20(24)25-4-2)27-10-11-28-21)12-18(23)22-17(13-26-19(15)22)14-8-6-5-7-9-14/h5-9,15-17,19H,3-4,10-13H2,1-2H3/t15-,16+,17-,19+/m0/s1 |
| InChIKey | KAOGZLHXFFOWHN-MJQMVNBJSA-N |
| XLogP | 3.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |