C23H25NO2S2 — CID 11384358
(3R,7R,8aR)-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11384358) has the molecular formula C23H25NO2S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (3R,7R,8aR)-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,7R,8aR)-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11384358 |
| Molecular Formula | C23H25NO2S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (3R,7R,8aR)-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | O=C1C[C@H](C2(c3ccccc3)SCCCS2)C[C@H]2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C23H25NO2S2/c25-21-14-19(23(27-12-7-13-28-23)18-10-5-2-6-11-18)15-22-24(21)20(16-26-22)17-8-3-1-4-9-17/h1-6,8-11,19-20,22H,7,12-16H2/t19-,20-,22+/m0/s1 |
| InChIKey | NCWRXLWEJNQUBH-JAXLGGSGSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |