C50H58N2O4S4 — CID 139089679
(3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 139089679) has the molecular formula C50H58N2O4S4 and a molecular weight of 879.29 g/mol. Its IUPAC name is (3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 139089679 |
| Molecular Formula | C50H58N2O4S4 |
| Molecular Weight | 879.29 g/mol |
| Exact Mass | 878.33 |
| IUPAC Name | (3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC[C@@H]1[C@H]2OC[C@@H](c3ccccc3)N2C(=O)C[C@H]1C1(c2ccccc2)SCCCS1.CC[C@@H]1[C@H]2OC[C@@H](c3ccccc3)N2C(=O)C[C@H]1C1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/2C25H29NO2S2/c2*1-2-20-21(25(29-14-9-15-30-25)19-12-7-4-8-13-19)16-23(27)26-22(17-28-24(20)26)18-10-5-3-6-11-18/h2*3-8,10-13,20-22,24H,2,9,14-17H2,1H3/t2*20-,21+,22-,24+/m00/s1 |
| InChIKey | CGDRUALVCYJFDO-DYEWZZMOSA-N |
| XLogP | 11.36 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.29 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |