C25H29NO2S2 — CID 11293580
(3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11293580) has the molecular formula C25H29NO2S2 and a molecular weight of 439.65 g/mol. Its IUPAC name is (3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11293580 |
| Molecular Formula | C25H29NO2S2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (3R,7R,8S,8aR)-8-ethyl-3-phenyl-7-(2-phenyl-1,3-dithian-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC[C@@H]1[C@H]2OC[C@@H](c3ccccc3)N2C(=O)C[C@H]1C1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C25H29NO2S2/c1-2-20-21(25(29-14-9-15-30-25)19-12-7-4-8-13-19)16-23(27)26-22(17-28-24(20)26)18-10-5-3-6-11-18/h3-8,10-13,20-22,24H,2,9,14-17H2,1H3/t20-,21+,22-,24+/m0/s1 |
| InChIKey | ZTWRBSMSTTVYNQ-HYVLGVRCSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |