C20H21NO2 — CID 11522402
(3R,6S,8aR)-6-benzyl-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11522402) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3R,6S,8aR)-6-benzyl-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,6S,8aR)-6-benzyl-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11522402 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R,6S,8aR)-6-benzyl-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | O=C1[C@H](Cc2ccccc2)CC[C@H]2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C20H21NO2/c22-20-17(13-15-7-3-1-4-8-15)11-12-19-21(20)18(14-23-19)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18-,19+/m0/s1 |
| InChIKey | VXLZPVAMANHALJ-GBESFXJTSA-N |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |