C25H23NO2 — CID 134865520
(4S,7R,8R,8aS)-4,7,8-triphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 134865520) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is (4S,7R,8R,8aS)-4,7,8-triphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4S,7R,8R,8aS)-4,7,8-triphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 134865520 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (4S,7R,8R,8aS)-4,7,8-triphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N2C[C@@H](c3ccccc3)[C@H](c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C25H23NO2/c27-25-24-23(20-14-8-3-9-15-20)21(18-10-4-1-5-11-18)16-26(24)22(17-28-25)19-12-6-2-7-13-19/h1-15,21-24H,16-17H2/t21-,22+,23-,24-/m0/s1 |
| InChIKey | TWXHOORGLXKBCG-KIHHCIJBSA-N |
| XLogP | 4.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |