C19H18FNO2 — CID 58110194
(3S,8aS)-8a-(4-fluorophenyl)-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 58110194) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is (3S,8aS)-8a-(4-fluorophenyl)-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3S,8aS)-8a-(4-fluorophenyl)-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 58110194 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3S,8aS)-8a-(4-fluorophenyl)-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | O=C1CCC[C@@]2(c3ccc(F)cc3)OC[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C19H18FNO2/c20-16-10-8-15(9-11-16)19-12-4-7-18(22)21(19)17(13-23-19)14-5-2-1-3-6-14/h1-3,5-6,8-11,17H,4,7,12-13H2/t17-,19+/m1/s1 |
| InChIKey | KKYROIXBOFHXNF-MJGOQNOKSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |