C22H25NO2 — CID 16723843
(3R,6S,8aS)-6-benzyl-6-ethyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 16723843) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (3R,6S,8aS)-6-benzyl-6-ethyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,6S,8aS)-6-benzyl-6-ethyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 16723843 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (3R,6S,8aS)-6-benzyl-6-ethyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC[C@@]1(Cc2ccccc2)CC[C@@H]2OC[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C22H25NO2/c1-2-22(15-17-9-5-3-6-10-17)14-13-20-23(21(22)24)19(16-25-20)18-11-7-4-8-12-18/h3-12,19-20H,2,13-16H2,1H3/t19-,20-,22-/m0/s1 |
| InChIKey | WGYUXVOGAFCQGA-ONTIZHBOSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |