C18H24FNO2 — CID 176754058
(3S,4aS,7aR)-1-benzyl-4a-(ethoxymethyl)-3-fluoro-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one (PubChem CID 176754058) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is (3S,4aS,7aR)-1-benzyl-4a-(ethoxymethyl)-3-fluoro-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one.
| Compound Name | (3S,4aS,7aR)-1-benzyl-4a-(ethoxymethyl)-3-fluoro-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one |
|---|---|
| PubChem CID | 176754058 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3S,4aS,7aR)-1-benzyl-4a-(ethoxymethyl)-3-fluoro-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one |
| SMILES | CCOC[C@]12CCC[C@H]1N(Cc1ccccc1)C(=O)[C@@H](F)C2 |
| InChI | InChI=1S/C18H24FNO2/c1-2-22-13-18-10-6-9-16(18)20(17(21)15(19)11-18)12-14-7-4-3-5-8-14/h3-5,7-8,15-16H,2,6,9-13H2,1H3/t15-,16+,18+/m0/s1 |
| InChIKey | RUCDHBCEKASZLP-LZLYRXPVSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |