C16H20FNO2 — CID 176754085
(3S,4aS,7aR)-1-benzyl-3-fluoro-4a-(hydroxymethyl)-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one (PubChem CID 176754085) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is (3S,4aS,7aR)-1-benzyl-3-fluoro-4a-(hydroxymethyl)-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one.
| Compound Name | (3S,4aS,7aR)-1-benzyl-3-fluoro-4a-(hydroxymethyl)-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one |
|---|---|
| PubChem CID | 176754085 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3S,4aS,7aR)-1-benzyl-3-fluoro-4a-(hydroxymethyl)-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-2-one |
| SMILES | O=C1[C@@H](F)C[C@@]2(CO)CCC[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C16H20FNO2/c17-13-9-16(11-19)8-4-7-14(16)18(15(13)20)10-12-5-2-1-3-6-12/h1-3,5-6,13-14,19H,4,7-11H2/t13-,14+,16+/m0/s1 |
| InChIKey | SWWWLJIEBHOHPQ-SQWLQELKSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |