C19H24FNO3 — CID 178162537
ethyl (4aR,7aS)-7-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridine-4a-carboxylate (PubChem CID 178162537) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is ethyl (4aR,7aS)-7-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | ethyl (4aR,7aS)-7-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 178162537 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl (4aR,7aS)-7-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridine-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC(=O)N([C@@H](C)c3ccccc3)[C@@H]1C(F)CC2 |
| InChI | InChI=1S/C19H24FNO3/c1-3-24-18(23)19-11-9-15(20)17(19)21(16(22)10-12-19)13(2)14-7-5-4-6-8-14/h4-8,13,15,17H,3,9-12H2,1-2H3/t13-,15?,17+,19-/m0/s1 |
| InChIKey | LXTSAVAXFVRVGO-JWSZVXGGSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |