C17H19FN2O4 — CID 144616473
methyl (7S)-6-(4-fluorophenyl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 144616473) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is methyl (7S)-6-(4-fluorophenyl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl (7S)-6-(4-fluorophenyl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 144616473 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl (7S)-6-(4-fluorophenyl)-2,7-dimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC2C(=O)N(C)CC(=O)N2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2O4/c1-17(16(23)24-3)8-12-15(22)19(2)9-13(21)20(12)14(17)10-4-6-11(18)7-5-10/h4-7,12,14H,8-9H2,1-3H3/t12?,14?,17-/m0/s1 |
| InChIKey | NSSTXBJVUSAGNA-AJUCZRQESA-N |
| XLogP | 1.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |