C18H23NO2 — CID 16724801
(3S,6R,8aR)-6-ethyl-3-phenyl-6-prop-2-enyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 16724801) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (3S,6R,8aR)-6-ethyl-3-phenyl-6-prop-2-enyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3S,6R,8aR)-6-ethyl-3-phenyl-6-prop-2-enyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 16724801 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (3S,6R,8aR)-6-ethyl-3-phenyl-6-prop-2-enyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | C=CC[C@@]1(CC)CC[C@H]2OC[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C18H23NO2/c1-3-11-18(4-2)12-10-16-19(17(18)20)15(13-21-16)14-8-6-5-7-9-14/h3,5-9,15-16H,1,4,10-13H2,2H3/t15-,16-,18+/m1/s1 |
| InChIKey | XSAVZXRJQPNUKI-NUJGCVRESA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|