C20H27NO2S2 — CID 101425410
(3R,8R,8aR)-8-[2-(2-methyl-1,3-dithian-2-yl)ethyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 101425410) has the molecular formula C20H27NO2S2 and a molecular weight of 377.58 g/mol. Its IUPAC name is (3R,8R,8aR)-8-[2-(2-methyl-1,3-dithian-2-yl)ethyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,8R,8aR)-8-[2-(2-methyl-1,3-dithian-2-yl)ethyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 101425410 |
| Molecular Formula | C20H27NO2S2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (3R,8R,8aR)-8-[2-(2-methyl-1,3-dithian-2-yl)ethyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC1(CC[C@H]2CCC(=O)N3[C@@H]2OC[C@H]3c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C20H27NO2S2/c1-20(24-12-5-13-25-20)11-10-16-8-9-18(22)21-17(14-23-19(16)21)15-6-3-2-4-7-15/h2-4,6-7,16-17,19H,5,8-14H2,1H3/t16-,17+,19-/m1/s1 |
| InChIKey | MPRMRTSYDWGRAS-ZIFCJYIRSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |