C16H21NO2 — CID 11601337
(3R,6S,8aS)-6-ethyl-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11601337) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (3R,6S,8aS)-6-ethyl-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,6S,8aS)-6-ethyl-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11601337 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3R,6S,8aS)-6-ethyl-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC[C@H]1CC[C@]2(C)OC[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C16H21NO2/c1-3-12-9-10-16(2)17(15(12)18)14(11-19-16)13-7-5-4-6-8-13/h4-8,12,14H,3,9-11H2,1-2H3/t12-,14-,16-/m0/s1 |
| InChIKey | CVUPINAJUVIFFA-NOLJZWGESA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |