C19H25NO4 — CID 11450361
ethyl 2-[(3R,7S,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate (PubChem CID 11450361) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl 2-[(3R,7S,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate.
| Compound Name | ethyl 2-[(3R,7S,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate |
|---|---|
| PubChem CID | 11450361 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl 2-[(3R,7S,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-7-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC(=O)N2[C@H](OC[C@H]2c2ccccc2)[C@H]1CC |
| InChI | InChI=1S/C19H25NO4/c1-3-15-14(11-18(22)23-4-2)10-17(21)20-16(12-24-19(15)20)13-8-6-5-7-9-13/h5-9,14-16,19H,3-4,10-12H2,1-2H3/t14-,15-,16-,19+/m0/s1 |
| InChIKey | SPIKRCVKBFGDDG-IUVQAAGXSA-N |
| XLogP | 2.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |