C16H17NO4 — CID 10957127
(1S,2S,6S,9R)-6-phenyl-4,11-dioxa-7-azatricyclo[7.4.0.02,7]tridecane-3,10-dione (PubChem CID 10957127) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (1S,2S,6S,9R)-6-phenyl-4,11-dioxa-7-azatricyclo[7.4.0.02,7]tridecane-3,10-dione.
| Compound Name | (1S,2S,6S,9R)-6-phenyl-4,11-dioxa-7-azatricyclo[7.4.0.02,7]tridecane-3,10-dione |
|---|---|
| PubChem CID | 10957127 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (1S,2S,6S,9R)-6-phenyl-4,11-dioxa-7-azatricyclo[7.4.0.02,7]tridecane-3,10-dione |
| SMILES | O=C1OCC[C@H]2[C@@H]1CN1[C@@H](c3ccccc3)COC(=O)[C@H]21 |
| InChI | InChI=1S/C16H17NO4/c18-15-12-8-17-13(10-4-2-1-3-5-10)9-21-16(19)14(17)11(12)6-7-20-15/h1-5,11-14H,6-9H2/t11-,12-,13+,14-/m0/s1 |
| InChIKey | NIACRBMCYISMFC-FQUUOJAGSA-N |
| XLogP | 1.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |