C23H25NO4Se — CID 11775487
methyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 11775487) has the molecular formula C23H25NO4Se and a molecular weight of 458.42 g/mol. Its IUPAC name is methyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | methyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 11775487 |
| Molecular Formula | C23H25NO4Se |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | methyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | CC[C@H]1CC([Se]c2ccccc2)(C(=O)OC)C(=O)N2[C@@H]1OC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H25NO4Se/c1-3-16-14-23(22(26)27-2,29-18-12-8-5-9-13-18)21(25)24-19(15-28-20(16)24)17-10-6-4-7-11-17/h4-13,16,19-20H,3,14-15H2,1-2H3/t16-,19-,20+,23?/m0/s1 |
| InChIKey | JEXUZBACTXBYCM-SRSMGXFPSA-N |
| XLogP | 2.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|