C21H29NO4 — CID 11530573
tert-butyl 2-[(3R,6R,8R,8aS)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]acetate (PubChem CID 11530573) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl 2-[(3R,6R,8R,8aS)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,6R,8R,8aS)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]acetate |
|---|---|
| PubChem CID | 11530573 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl 2-[(3R,6R,8R,8aS)-8-ethyl-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]acetate |
| SMILES | CC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)C(=O)N2[C@H](c3ccccc3)CO[C@@H]12 |
| InChI | InChI=1S/C21H29NO4/c1-5-14-11-16(12-18(23)26-21(2,3)4)19(24)22-17(13-25-20(14)22)15-9-7-6-8-10-15/h6-10,14,16-17,20H,5,11-13H2,1-4H3/t14-,16-,17+,20+/m1/s1 |
| InChIKey | NCOFNLUDTUUIGM-PYQAKABTSA-N |
| XLogP | 3.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |