C29H29NO4Se — CID 11156878
benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 11156878) has the molecular formula C29H29NO4Se and a molecular weight of 534.51 g/mol. Its IUPAC name is benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 11156878 |
| Molecular Formula | C29H29NO4Se |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-6-phenylselanyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | CC[C@H]1CC([Se]c2ccccc2)(C(=O)OCc2ccccc2)C(=O)N2[C@@H]1OC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C29H29NO4Se/c1-2-22-18-29(35-24-16-10-5-11-17-24,28(32)34-19-21-12-6-3-7-13-21)27(31)30-25(20-33-26(22)30)23-14-8-4-9-15-23/h3-17,22,25-26H,2,18-20H2,1H3/t22-,25-,26+,29?/m0/s1 |
| InChIKey | SLTUQIJXTUZZDJ-MLUDQSQXSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|