C28H25NO4 — CID 101470413
ethyl (1S,2S,4R,7R)-5-oxo-3,3,7-triphenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate (PubChem CID 101470413) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl (1S,2S,4R,7R)-5-oxo-3,3,7-triphenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate.
| Compound Name | ethyl (1S,2S,4R,7R)-5-oxo-3,3,7-triphenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate |
|---|---|
| PubChem CID | 101470413 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl (1S,2S,4R,7R)-5-oxo-3,3,7-triphenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=O)N3[C@@H](c4ccccc4)OC[C@@H]3[C@H]1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25NO4/c1-2-32-26(31)28-23(22-18-33-24(29(22)25(28)30)19-12-6-3-7-13-19)27(28,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-24H,2,18H2,1H3/t22-,23+,24-,28-/m1/s1 |
| InChIKey | SCJCHBMVZDZPEP-GFXAMXPBSA-N |
| XLogP | 4.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|