C26H29NO4 — CID 15922347
benzyl (3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-7-prop-2-enyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 15922347) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is benzyl (3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-7-prop-2-enyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | benzyl (3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-7-prop-2-enyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 15922347 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | benzyl (3R,7R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-7-prop-2-enyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | C=CC[C@H]1C(C(=O)OCc2ccccc2)C(=O)N2[C@H](OC[C@H]2c2ccccc2)[C@H]1CC |
| InChI | InChI=1S/C26H29NO4/c1-3-11-21-20(4-2)25-27(22(17-30-25)19-14-9-6-10-15-19)24(28)23(21)26(29)31-16-18-12-7-5-8-13-18/h3,5-10,12-15,20-23,25H,1,4,11,16-17H2,2H3/t20-,21+,22-,23?,25+/m0/s1 |
| InChIKey | VTWGJVAJSZHQIZ-VBGGHLDGSA-N |
| XLogP | 4.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|