C23H23NO4 — CID 11280351
benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 11280351) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 11280351 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | benzyl (3R,8S,8aR)-8-ethyl-5-oxo-3-phenyl-2,3,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | CC[C@H]1C=C(C(=O)OCc2ccccc2)C(=O)N2[C@@H]1OC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H23NO4/c1-2-17-13-19(23(26)28-14-16-9-5-3-6-10-16)21(25)24-20(15-27-22(17)24)18-11-7-4-8-12-18/h3-13,17,20,22H,2,14-15H2,1H3/t17-,20-,22+/m0/s1 |
| InChIKey | ZDWMWLPVDHBMKV-RBDMOPTHSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|