C13H16O2S — CID 102024528
(3R)-3-(3-methoxyphenyl)sulfanylcyclohexan-1-one (PubChem CID 102024528) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is (3R)-3-(3-methoxyphenyl)sulfanylcyclohexan-1-one.
| Compound Name | (3R)-3-(3-methoxyphenyl)sulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 102024528 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (3R)-3-(3-methoxyphenyl)sulfanylcyclohexan-1-one |
| SMILES | COc1cccc(S[C@@H]2CCCC(=O)C2)c1 |
| InChI | InChI=1S/C13H16O2S/c1-15-11-5-3-7-13(9-11)16-12-6-2-4-10(14)8-12/h3,5,7,9,12H,2,4,6,8H2,1H3/t12-/m1/s1 |
| InChIKey | RLROTPJPGDEONY-GFCCVEGCSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |