C14H18S — CID 142055381
1-methyl-3-(3-methylidenecyclohexyl)sulfanylbenzene (PubChem CID 142055381) has the molecular formula C14H18S and a molecular weight of 218.37 g/mol. Its IUPAC name is 1-methyl-3-(3-methylidenecyclohexyl)sulfanylbenzene.
| Compound Name | 1-methyl-3-(3-methylidenecyclohexyl)sulfanylbenzene |
|---|---|
| PubChem CID | 142055381 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-methyl-3-(3-methylidenecyclohexyl)sulfanylbenzene |
| SMILES | C=C1CCCC(Sc2cccc(C)c2)C1 |
| InChI | InChI=1S/C14H18S/c1-11-5-3-7-13(9-11)15-14-8-4-6-12(2)10-14/h4,6,8,10,13H,1,3,5,7,9H2,2H3 |
| InChIKey | SNFNFIXYNGPREQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|