C9H13IO2 — CID 102025085
(4R,5R)-4-ethyl-5-[(Z)-1-iodoprop-1-enyl]oxolan-2-one (PubChem CID 102025085) has the molecular formula C9H13IO2 and a molecular weight of 280.10 g/mol. Its IUPAC name is (4R,5R)-4-ethyl-5-[(Z)-1-iodoprop-1-enyl]oxolan-2-one.
| Compound Name | (4R,5R)-4-ethyl-5-[(Z)-1-iodoprop-1-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 102025085 |
| Molecular Formula | C9H13IO2 |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (4R,5R)-4-ethyl-5-[(Z)-1-iodoprop-1-enyl]oxolan-2-one |
| SMILES | C/C=C(\I)[C@@H]1OC(=O)C[C@H]1CC |
| InChI | InChI=1S/C9H13IO2/c1-3-6-5-8(11)12-9(6)7(10)4-2/h4,6,9H,3,5H2,1-2H3/b7-4-/t6-,9-/m1/s1 |
| InChIKey | SJGMURDFMGTCSC-SJNNWYEASA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|