C17H14N2O2 — CID 102025482
(3R)-1-methyl-3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-3H-indol-2-one (PubChem CID 102025482) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3R)-1-methyl-3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-3H-indol-2-one.
| Compound Name | (3R)-1-methyl-3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-3H-indol-2-one |
|---|---|
| PubChem CID | 102025482 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (3R)-1-methyl-3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-3H-indol-2-one |
| SMILES | CN1C(=O)[C@H]([C@H]2C(=O)Nc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C17H14N2O2/c1-19-13-9-5-3-7-11(13)15(17(19)21)14-10-6-2-4-8-12(10)18-16(14)20/h2-9,14-15H,1H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | JZGKYBFTZFBIEV-GJZGRUSLSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |