C19H34O11 — CID 102025585
(1S,3R,4S,5R,6R,8R,11R,12S,13R,14R)-4,5,6,12,13,14-hexamethoxy-11-(methoxymethyl)-2,7,10,15-tetraoxatricyclo[9.3.1.03,8]pentadecane (PubChem CID 102025585) has the molecular formula C19H34O11 and a molecular weight of 438.47 g/mol. Its IUPAC name is (1S,3R,4S,5R,6R,8R,11R,12S,13R,14R)-4,5,6,12,13,14-hexamethoxy-11-(methoxymethyl)-2,7,10,15-tetraoxatricyclo[9.3.1.03,8]pentadecane.
| Compound Name | (1S,3R,4S,5R,6R,8R,11R,12S,13R,14R)-4,5,6,12,13,14-hexamethoxy-11-(methoxymethyl)-2,7,10,15-tetraoxatricyclo[9.3.1.03,8]pentadecane |
|---|---|
| PubChem CID | 102025585 |
| Molecular Formula | C19H34O11 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (1S,3R,4S,5R,6R,8R,11R,12S,13R,14R)-4,5,6,12,13,14-hexamethoxy-11-(methoxymethyl)-2,7,10,15-tetraoxatricyclo[9.3.1.03,8]pentadecane |
| SMILES | COC[C@@]12OC[C@H]3O[C@@H](OC)[C@H](OC)[C@@H](OC)[C@@H]3O[C@@H](O1)[C@H](OC)[C@@H](OC)[C@@H]2OC |
| InChI | InChI=1S/C19H34O11/c1-20-9-19-16(25-6)13(22-3)15(24-5)18(30-19)29-11-10(8-27-19)28-17(26-7)14(23-4)12(11)21-2/h10-18H,8-9H2,1-7H3/t10-,11-,12+,13-,14-,15-,16+,17-,18+,19-/m1/s1 |
| InChIKey | JOKDZBJLHKSRJT-VJPBGDPJSA-N |
| XLogP | -0.45 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |