C20H43N2O2PSSi — CID 102025933
cis-methyl (1R,2R)-2-bis[di(propan-2-yl)amino]phosphinothioyl-2-trimethylsilylcyclopropane-1-carboxylate (PubChem CID 102025933) has the molecular formula C20H43N2O2PSSi and a molecular weight of 434.70 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-bis[di(propan-2-yl)amino]phosphinothioyl-2-trimethylsilylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-bis[di(propan-2-yl)amino]phosphinothioyl-2-trimethylsilylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102025933 |
| Molecular Formula | C20H43N2O2PSSi |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | cis-methyl (1R,2R)-2-bis[di(propan-2-yl)amino]phosphinothioyl-2-trimethylsilylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]1([Si](C)(C)C)P(=S)(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H43N2O2PSSi/c1-14(2)21(15(3)4)25(26,22(16(5)6)17(7)8)20(27(10,11)12)13-18(20)19(23)24-9/h14-18H,13H2,1-12H3/t18-,20+/m1/s1 |
| InChIKey | AKFWKYFELFKTBU-QUCCMNQESA-N |
| XLogP | 5.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|