C25H33FN4O — CID 10202611
1-[4-(dimethylamino)phenyl]-3-[1-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]cyclobutyl]urea (PubChem CID 10202611) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[1-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]cyclobutyl]urea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[1-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]cyclobutyl]urea |
|---|---|
| PubChem CID | 10202611 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[1-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]cyclobutyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)NC2(CN3CCCC3Cc3ccc(F)cc3)CCC2)cc1 |
| InChI | InChI=1S/C25H33FN4O/c1-29(2)22-12-10-21(11-13-22)27-24(31)28-25(14-4-15-25)18-30-16-3-5-23(30)17-19-6-8-20(26)9-7-19/h6-13,23H,3-5,14-18H2,1-2H3,(H2,27,28,31) |
| InChIKey | XCAOXXNLBOFQDI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|