C14H9Cl3O2S — CID 102026297
(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride (PubChem CID 102026297) has the molecular formula C14H9Cl3O2S and a molecular weight of 347.65 g/mol. Its IUPAC name is (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride.
| Compound Name | (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 102026297 |
| Molecular Formula | C14H9Cl3O2S |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC1c2cc(Cl)ccc2-c2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H9Cl3O2S/c15-8-1-3-10-11-4-2-9(16)6-13(11)14(12(10)5-8)7-20(17,18)19/h1-6,14H,7H2 |
| InChIKey | STJSUHRVYNICRX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |