(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride

C14H9Cl3O2S — CID 102026297

IUPAC(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1c2cc(Cl)ccc2-c2ccc(Cl)cc21
InChIInChI=1S/C14H9Cl3O2S/c15-8-1-3-10-11-4-2-9(16)6-13(11)14(12(10)5-8)7-20(17,18)19/h1-6,14H,7H2
InChIKeySTJSUHRVYNICRX-UHFFFAOYSA-N
MW347.65 g/mol
LogP4.67
Rot. Bonds2

About (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride

(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride (PubChem CID 102026297) has the molecular formula C14H9Cl3O2S and a molecular weight of 347.65 g/mol. Its IUPAC name is (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride.

Molecular Properties

Compound Name(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride
PubChem CID102026297
Molecular FormulaC14H9Cl3O2S
Molecular Weight347.65 g/mol
Exact Mass345.94
IUPAC Name(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1c2cc(Cl)ccc2-c2ccc(Cl)cc21
InChIInChI=1S/C14H9Cl3O2S/c15-8-1-3-10-11-4-2-9(16)6-13(11)14(12(10)5-8)7-20(17,18)19/h1-6,14H,7H2
InChIKeySTJSUHRVYNICRX-UHFFFAOYSA-N
XLogP4.67
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.65
LogP ≤ 54.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride?
The IUPAC name of (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride (CID 102026297) is (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride.
What is the SMILES notation for (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride?
The canonical SMILES for (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride is O=S(=O)(Cl)CC1c2cc(Cl)ccc2-c2ccc(Cl)cc21.
What is the InChIKey of (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride?
The InChIKey is STJSUHRVYNICRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl3O2S/c15-8-1-3-10-11-4-2-9(16)6-13(11)14(12(10)5-8)7-20(17,18)19/h1-6,14H,7H2.
What are the key properties of (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride?
(2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride has a molecular weight of 347.65 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-dichloro-9H-fluoren-9-yl)methanesulfonyl chloride is sourced from PubChem (CID 102026297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).