C11H22O3S — CID 102026405
(E,3S)-1-tert-butylsulfonyl-4,4-dimethylpent-1-en-3-ol (PubChem CID 102026405) has the molecular formula C11H22O3S and a molecular weight of 234.36 g/mol. Its IUPAC name is (E,3S)-1-tert-butylsulfonyl-4,4-dimethylpent-1-en-3-ol.
| Compound Name | (E,3S)-1-tert-butylsulfonyl-4,4-dimethylpent-1-en-3-ol |
|---|---|
| PubChem CID | 102026405 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E,3S)-1-tert-butylsulfonyl-4,4-dimethylpent-1-en-3-ol |
| SMILES | CC(C)(C)[C@@H](O)/C=C/S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O3S/c1-10(2,3)9(12)7-8-15(13,14)11(4,5)6/h7-9,12H,1-6H3/b8-7+/t9-/m0/s1 |
| InChIKey | FRXHBXRIYIDVPW-FLOXNTQESA-N |
| XLogP | 2.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |