C10H20O3S — CID 177416650
(2S,5S)-6,6-dimethyl-5-methylsulfonylhept-3-en-2-ol (PubChem CID 177416650) has the molecular formula C10H20O3S and a molecular weight of 220.33 g/mol. Its IUPAC name is (2S,5S)-6,6-dimethyl-5-methylsulfonylhept-3-en-2-ol.
| Compound Name | (2S,5S)-6,6-dimethyl-5-methylsulfonylhept-3-en-2-ol |
|---|---|
| PubChem CID | 177416650 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2S,5S)-6,6-dimethyl-5-methylsulfonylhept-3-en-2-ol |
| SMILES | C[C@H](O)C=C[C@@H](C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C10H20O3S/c1-8(11)6-7-9(10(2,3)4)14(5,12)13/h6-9,11H,1-5H3/t8-,9-/m0/s1 |
| InChIKey | GJMNATAKQCWBSY-IUCAKERBSA-N |
| XLogP | 1.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|