C8H16O3S — CID 115817162
5-methyl-2-methylsulfonylhex-4-en-3-ol (PubChem CID 115817162) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is 5-methyl-2-methylsulfonylhex-4-en-3-ol.
| Compound Name | 5-methyl-2-methylsulfonylhex-4-en-3-ol |
|---|---|
| PubChem CID | 115817162 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-methyl-2-methylsulfonylhex-4-en-3-ol |
| SMILES | CC(C)=CC(O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C8H16O3S/c1-6(2)5-8(9)7(3)12(4,10)11/h5,7-9H,1-4H3 |
| InChIKey | YSWOUGVUHDWKKP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|